| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:01:16 UTC |
|---|
| Update Date | 2025-03-21 18:06:47 UTC |
|---|
| HMDB ID | HMDB0255751 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065155 |
|---|
| Name | Norscopolamine |
|---|
| Frequency | 47.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO4 |
|---|
| Molecular Mass | 289.1314 |
|---|
| SMILES | O=C(OC1CC2NC(C1)C1OC21)C(CO)c1ccccc1 |
|---|
| InChI Key | MOYZEMOPQDTDHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersdialkyl ethersdialkylaminesepoxideshydrocarbon derivativesmonocarboxylic acids and derivativesmorpholinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinesprimary alcoholspyrrolidines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidineprimary alcoholpiperidineorganoheterocyclic compoundalcoholsecondary aliphatic amineazacycleoxiranesecondary amineoxazinaneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
