| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:01:19 UTC |
|---|
| Update Date | 2025-03-21 18:06:49 UTC |
|---|
| HMDB ID | HMDB0040314 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065281 |
|---|
| Name | 2,4',5,7-Tetrahydroxyflavanone |
|---|
| Frequency | 46.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O6 |
|---|
| Molecular Mass | 288.0634 |
|---|
| SMILES | O=C1CC(O)(c2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | NFENYLPEYDNIMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanshemiacetalshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketone1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidketoneorganic oxidechromonearomatic heteropolycyclic compoundchromanehemiacetalorganoheterocyclic compoundbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
