| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:22 UTC |
|---|
| Update Date | 2025-03-21 18:06:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065425 |
|---|
| Frequency | 46.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N2O7P+ |
|---|
| Molecular Mass | 317.0533 |
|---|
| SMILES | NC(=O)c1ccc[n+](C2OC(CO)C3OP(=O)(O)OC32)c1 |
|---|
| InChI Key | FGZMHRBGSATBOK-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acids and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesnicotinamidesorganic cationsorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary carboxylic acid amidespyridinecarboxylic acids and derivativestetrahydrofuransvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidepyridine carboxylic acid or derivativesnicotinamidecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganic cationprimary alcoholorganoheterocyclic compoundribonucleoside 3'-phosphatealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundhydroxypyridine1,3_dioxaphospholanecarboxamide groupoxacyclepyridineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|