| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:23 UTC |
|---|
| Update Date | 2025-03-21 18:06:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065437 |
|---|
| Frequency | 46.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14ClNO9 |
|---|
| Molecular Mass | 375.0357 |
|---|
| SMILES | O=C1Nc2ccc(Cl)cc2OC1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | YTPCIIUWGZXVTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsaryl chloridesazacyclic compoundsbenzenoidsbenzomorpholinesbenzoxazinonesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidorganochlorideo-glucuronidemonosaccharidecarboxylic acid derivativeorganohalogen compoundpyran carboxylic acidbenzomorpholine1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundaryl chloridealcoholpyran carboxylic acid or derivativesazacyclebenzoxazinehydroxy acidcarboxamide groupoxazinanearyl halideoxacyclesecondary carboxylic acid amidemorpholinemonocarboxylic acid or derivativesbenzoxazinonepyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
