| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:23 UTC |
|---|
| Update Date | 2025-03-21 18:06:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065461 |
|---|
| Frequency | 46.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H29N6O6+ |
|---|
| Molecular Mass | 413.2143 |
|---|
| SMILES | Nc1n[n+](CCCCC(N)C(=O)O)cc(CCC(N)C(=O)O)c1CC(N)C(=O)O |
|---|
| InChI Key | BXMLSQNUEQHODQ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkylaminesorganic cationsorganic oxidesorganopnictogen compoundspyridazines and derivativestricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidtricarboxylic acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic cationimidolactamorganoheterocyclic compoundazacycleheteroaromatic compoundorganic oxygen compoundpyridazinehydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|