DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 00:01:25 UTC
Update Date	2025-03-21 18:06:51 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00065532
Frequency	46.7
Structure
Chemical Formula	C₁₉H₂₀N₂O₆
Molecular Mass	372.1321
SMILES	O=C(O)CCC(NC(=O)c1ccc(NCc2ccccc2O)cc1)C(=O)O
InChI Key	KJEQLKYHJGUBMT-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	glutamic acid and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids alpha amino acids amino acids benzoyl derivatives carbonyl compounds carboxylic acids dicarboxylic acids and derivatives hippuric acids and derivatives hydrocarbon derivatives n-acyl-alpha amino acids organic oxides organopnictogen compounds phenylalkylamines secondary alkylarylamines secondary carboxylic acid amides
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid amino acid benzoyl 1-hydroxy-2-unsubstituted benzenoid benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound n-acyl-alpha amino acid or derivatives n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives glutamic acid or derivatives 1-hydroxy-4-unsubstituted benzenoid secondary amine carboxamide group secondary aliphatic/aromatic amine aromatic homomonocyclic compound secondary carboxylic acid amide organic oxygen compound dicarboxylic acid or derivatives phenylalkylamine phenol hydrocarbon derivative benzenoid organic nitrogen compound amine organooxygen compound

Showing information for DMID00065532