| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:35 UTC |
|---|
| Update Date | 2025-03-21 18:06:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065934 |
|---|
| Frequency | 46.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O3 |
|---|
| Molecular Mass | 254.0943 |
|---|
| SMILES | COc1ccc2c(c1)-c1cc3c(cc1CC2)OCO3 |
|---|
| InChI Key | WMWMSSILZAFRAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesbenzodioxoleshydrocarbon derivativesnaphthalenesoxacyclic compounds |
|---|
| Substituents | phenol etherphenanthreneetheralkyl aryl etheroxacyclenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundanisolehydrocarbon derivativeorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|