| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:36 UTC |
|---|
| Update Date | 2025-03-21 18:06:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065981 |
|---|
| Frequency | 46.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N4O8P |
|---|
| Molecular Mass | 348.0471 |
|---|
| SMILES | O=P(O)(O)Oc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | YUPDSCJDJDODAS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl phosphomonoestersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monosaccharideimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativearyl phosphomonoesterpurineorganic nitrogen compoundaryl phosphateorganic phosphoric acid derivativeorganooxygen compound |
|---|