DeepMet

Record Information
HMDB Status	detected
Creation Date	2024-02-21 00:01:37 UTC
Update Date	2025-03-21 18:06:55 UTC
HMDB ID	HMDB0255088
Metabolite Identification
DeepMet ID	DMID00066023
Name	N-Benzoyl-L-tyrosine
Frequency	51.7
Structure
Chemical Formula	C₁₆H₁₅NO₄
Molecular Mass	285.1001
SMILES	O=C(NC(Cc1ccc(O)cc1)C(=O)O)c1ccccc1
InChI Key	KUUUDPTUEOKITK-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	tyrosine and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acids amphetamines and derivatives benzoyl derivatives carbonyl compounds carboxylic acids hippuric acids and derivatives hydrocarbon derivatives monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives phenylpropanoic acids secondary carboxylic acid amides
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid 3-phenylpropanoic-acid benzoyl 1-hydroxy-2-unsubstituted benzenoid benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives tyrosine or derivatives n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid organic nitrogen compound organooxygen compound

Showing information for DMID00066023