| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:37 UTC |
|---|
| Update Date | 2025-03-21 18:06:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066024 |
|---|
| Frequency | 46.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O10S |
|---|
| Molecular Mass | 276.0151 |
|---|
| SMILES | O=C(O)C(O)C(O)C(O)C(O)COS(=O)(=O)O |
|---|
| InChI Key | ACNVLPBLRLGASF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | sulfated fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | aliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativemedium-chain hydroxy acidbeta-hydroxy acidsaccharideorganic oxidealkyl sulfatemedium-chain fatty acidhydroxy fatty acidalcoholorganic sulfuric acid or derivativeshydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundsulfated fatty acidsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|