| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:38 UTC |
|---|
| Update Date | 2025-03-21 18:06:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066061 |
|---|
| Frequency | 46.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O2S |
|---|
| Molecular Mass | 250.0776 |
|---|
| SMILES | O=C1NC2CSC(Cc3ccc(O)cc3)C2N1 |
|---|
| InChI Key | KDMFSTANLHGNLW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundsdialkylthioethershydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinemonocyclic benzene moietycarbonyl groupcarbonic acid derivativeazacycledialkylthioether1-hydroxy-2-unsubstituted benzenoidthienoimidazolidinethiopheneimidazolidinoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundthioetherorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
