| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:40 UTC |
|---|
| Update Date | 2025-03-21 18:06:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066114 |
|---|
| Frequency | 46.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7NO3 |
|---|
| Molecular Mass | 177.0426 |
|---|
| SMILES | O=C(O)c1c(O)ccc2[nH]ccc12 |
|---|
| InChI Key | OLHKLUSLUSTNIS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolessalicylic acid and derivativesvinylogous acids |
|---|
| Substituents | carboxylic acidindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundazacycleheteroaromatic compoundhydroxybenzoic acidvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesindolecarboxylic acidpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|