| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:40 UTC |
|---|
| Update Date | 2025-03-21 18:06:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066144 |
|---|
| Frequency | 46.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11O7P |
|---|
| Molecular Mass | 262.0242 |
|---|
| SMILES | O=C(O)CCc1ccc(OP(=O)(O)O)c(O)c1 |
|---|
| InChI Key | CXTFRXOITCNZBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenyl phosphates |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenyl phosphatecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterphenolhydrocarbon derivativearyl phosphomonoesterbenzenoidphenoxy compoundaryl phosphateorganic phosphoric acid derivativeorganooxygen compound |
|---|
