| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:44 UTC |
|---|
| Update Date | 2025-03-21 18:06:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066291 |
|---|
| Frequency | 46.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O10S |
|---|
| Molecular Mass | 271.9838 |
|---|
| SMILES | O=C1OOC(C(O)CO)C(OS(=O)(=O)O)=C1O |
|---|
| InChI Key | LIGFWTYRTYKHPA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholsulfuric acid monoestercarbonyl groupcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativeprimary alcoholorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
