| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:47 UTC |
|---|
| Update Date | 2025-03-21 18:06:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066391 |
|---|
| Frequency | 46.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O3S |
|---|
| Molecular Mass | 230.0725 |
|---|
| SMILES | O=C(O)CCC1SCC2CNC(=O)NC21 |
|---|
| InChI Key | VAPAUPVAJNNURS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdiazinanesfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthia fatty acidsthiolanes |
|---|
| Substituents | thiolanefatty acylcarbonyl groupcarbonic acid derivativecarboxylic acidazacycledialkylthioetherpyrimidonecarboxylic acid derivativealiphatic heteropolycyclic compound1,3-diazinaneorganic oxidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|