| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:49 UTC |
|---|
| Update Date | 2025-03-21 18:07:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066486 |
|---|
| Frequency | 45.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N2O2 |
|---|
| Molecular Mass | 244.1212 |
|---|
| SMILES | COc1ccc2[nH]cc(C3CCC(=O)N3C)c2c1 |
|---|
| InChI Key | GQLFHXSPBDTUPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolespyrrolidine-2-onestertiary carboxylic acid amides |
|---|
| Substituents | 2-pyrrolidonephenol ethercarbonyl groupetherlactamindolealkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneazacyclen-alkylpyrrolidineheteroaromatic compoundcarboxamide grouporganic oxygen compoundanisolepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
