| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:50 UTC |
|---|
| Update Date | 2025-03-21 18:07:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066512 |
|---|
| Frequency | 45.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18N2O5 |
|---|
| Molecular Mass | 330.1216 |
|---|
| SMILES | NC(Cc1ccc(Oc2ccc(O)cc2)cc1)C(=O)NCC(=O)O |
|---|
| InChI Key | GMDOJRXYJWCYPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativescarbonyl compoundscarboxylic acidsdiarylethersdipeptidesdiphenylethersfatty amideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylalanine and derivativessecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherfatty acylphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidfatty amide1-hydroxy-2-unsubstituted benzenoidalpha peptideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesalpha-amino acid amidecarboxamide groupn-acylglycinearomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compounddiphenyletherorganooxygen compound |
|---|
