| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:50 UTC |
|---|
| Update Date | 2025-03-21 18:07:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066548 |
|---|
| Frequency | 45.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N2O5 |
|---|
| Molecular Mass | 200.0433 |
|---|
| SMILES | O=C(O)CCC1C(=O)NC(=O)NC1=O |
|---|
| InChI Key | YARSJLGLRSDQOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | barbituric acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsazacyclic compoundscarboxylic acidsdiazinanesdicarboximideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | carbonyl groupcarbonic acid derivativecarboxylic acidazacyclebarbituratecarboxylic acid derivative1,3-diazinaneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compound1,3-dicarbonyl compoundorganooxygen compound |
|---|