| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:02 UTC |
|---|
| Update Date | 2025-03-21 18:07:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00066986 |
|---|
| Frequency | 45.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H21NO6 |
|---|
| Molecular Mass | 323.1369 |
|---|
| SMILES | CC(C)CC(NC(OC(=O)Cc1ccccc1)C(=O)O)C(=O)O |
|---|
| InChI Key | YLPUTFMRZNGVKM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | leucine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundstricarboxylic acids and derivatives |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietycarbonyl groupcarboxylic acidamino acidtricarboxylic acid or derivativessecondary aminearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|