| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:03 UTC |
|---|
| Update Date | 2025-03-21 18:07:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067042 |
|---|
| Frequency | 45.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O10S |
|---|
| Molecular Mass | 271.9838 |
|---|
| SMILES | O=C(O)C1OC(=O)C(OS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | TZSVTNPJQZAYCX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdelta valerolactonesdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarboxylic aciddelta valerolactonecarboxylic acid derivativepyran carboxylic acidlactonebeta-hydroxy acidorganic oxidegluconolactonealkyl sulfatealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacyclepyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativessulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|
