| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:03 UTC |
|---|
| Update Date | 2025-03-21 18:07:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067048 |
|---|
| Frequency | 45.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17NO7 |
|---|
| Molecular Mass | 251.1005 |
|---|
| SMILES | CC(OC1OC(CO)C(O)C(O)C1N)C(=O)O |
|---|
| InChI Key | GSRHNHSAOGKILS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesacetalaliphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compound |
|---|