DeepMet

Record Information
HMDB Status	detected
Creation Date	2024-02-21 00:02:05 UTC
Update Date	2025-03-21 18:07:06 UTC
HMDB ID	HMDB0259341
Metabolite Identification
DeepMet ID	DMID00067109
Name	Tyr-Gly-Gly-Phe-Gly-OH
Frequency	45.4
Structure
Chemical Formula	C₂₄H₂₉N₅O₇
Molecular Mass	499.2067
SMILES	NC(Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NCC(=O)O
InChI Key	CJXBPYBHEPRPPC-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic polymers
Class	polypeptides
Subclass	polypeptides
Direct Parent	polypeptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids acyl glycines alpha amino acid amides alpha amino acids amphetamines and derivatives benzene and substituted derivatives carbonyl compounds carboxylic acids fatty amides hydrocarbon derivatives monoalkylamines monocarboxylic acids and derivatives organic oxides organonitrogen compounds organopnictogen compounds peptides phenylalanine and derivatives secondary carboxylic acid amides tyrosine and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid fatty amide 1-hydroxy-2-unsubstituted benzenoid alpha-amino acid or derivatives carboxylic acid derivative alpha peptide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives polypeptide tyrosine or derivatives alpha-amino acid amide n-acyl-alpha-amino acid carboxamide group n-acylglycine n-substituted-alpha-amino acid aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID00067109