| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:06 UTC |
|---|
| Update Date | 2025-03-21 18:07:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067155 |
|---|
| Frequency | 45.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N2O3S |
|---|
| Molecular Mass | 200.0256 |
|---|
| SMILES | NC(=O)c1ccc(S(N)(=O)=O)cc1 |
|---|
| InChI Key | MWFFIRCXGDGFQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amideorganosulfonic acid or derivativesbenzoylorganosulfur compoundcarboxylic acid derivativebenzamideorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundbenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|