| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:06 UTC |
|---|
| Update Date | 2025-03-21 18:07:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067175 |
|---|
| Frequency | 45.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9NO3S |
|---|
| Molecular Mass | 247.0303 |
|---|
| SMILES | O=S(=O)(O)c1cccc2c1[nH]c1ccccc12 |
|---|
| InChI Key | WTZQJWITZKKMAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | carbazoles |
|---|
| Direct Parent | carbazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidspyrrolessulfonyls |
|---|
| Substituents | organosulfonic acid or derivatives1-sulfo,2-unsubstituted aromatic compoundazacycleindoleheteroaromatic compoundorganosulfonic acidorganosulfur compoundcarbazoleorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundorganic sulfonic acid or derivativespyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
