| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:08 UTC |
|---|
| Update Date | 2025-03-21 18:07:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067249 |
|---|
| Frequency | 45.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N3O5 |
|---|
| Molecular Mass | 281.1012 |
|---|
| SMILES | Nc1c(O)cccc1C(=O)CC(N)C(=O)NCC(=O)O |
|---|
| InChI Key | MREKHXTWGBFJMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl-phenylketonesalpha amino acid amidesalpha amino acidsamino acidsaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsdipeptideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaryl alkyl ketoneamino acidfatty amidebenzoyl1-hydroxy-2-unsubstituted benzenoidalpha peptideketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundvinylogous amidealpha-amino acid amide1-hydroxy-4-unsubstituted benzenoidcarboxamide groupn-acyl-aminen-acylglycinephenylketonebutyrophenonearomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineprimary amineorganic nitrogen compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|