| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:14 UTC |
|---|
| Update Date | 2025-03-21 18:07:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067468 |
|---|
| Frequency | 58.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N4O2S+ |
|---|
| Molecular Mass | 281.1067 |
|---|
| SMILES | Cc1nc(N)c(C[n+]2csc(CCO)c2C)c(=O)[nH]1 |
|---|
| InChI Key | NHBBNEANRWWVIG-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | thiamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4,5-disubstituted thiazolesalcohols and polyolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic cationsorganic oxidesorganopnictogen compoundsprimary aminespyrimidonesvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpyrimidoneorganic oxidethiamineorganonitrogen compoundorganopnictogen compoundorganic cationimidolactamazolealcoholvinylogous amideazacycleheteroaromatic compound4,5-disubstituted 1,3-thiazoleorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundthiazoleamineorganooxygen compound |
|---|
