| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:14 UTC |
|---|
| Update Date | 2025-03-21 18:07:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067498 |
|---|
| Frequency | 45.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18N2O |
|---|
| Molecular Mass | 278.1419 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)Cc1c[nH]c2ccccc12 |
|---|
| InChI Key | OPTJFWICBVXDLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | anilidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundspyrrolessecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupindolen-arylamidecarboxylic acid derivativexyleneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundazacycleheteroaromatic compoundm-xylenecarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
