| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:16 UTC |
|---|
| Update Date | 2025-03-21 18:07:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067555 |
|---|
| Frequency | 45.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H6O6 |
|---|
| Molecular Mass | 258.0164 |
|---|
| SMILES | O=c1oc2c(O)c(O)cc3oc4cc(O)cc1c4c32 |
|---|
| InChI Key | PQGWZURWGYWVOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | dibenzofurans |
|---|
| Direct Parent | dibenzofurans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyransbenzenoidscoumarins and derivativesfuransheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | furanbenzopyran1-benzopyrandibenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidisocoumarincoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoidorganooxygen compound |
|---|