| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:19 UTC |
|---|
| Update Date | 2025-03-21 18:07:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00067671 |
|---|
| Frequency | 44.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N5O6P |
|---|
| Molecular Mass | 321.0838 |
|---|
| SMILES | CC(OP(=O)(O)O)C(O)C1CNc2[nH]c(N)nc(=O)c2N1 |
|---|
| InChI Key | FUQUBYSALLBAOQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholvinylogous amidepterinazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
