| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:27 UTC |
|---|
| Update Date | 2025-03-21 18:07:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068000 |
|---|
| Frequency | 44.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O12S2 |
|---|
| Molecular Mass | 339.977 |
|---|
| SMILES | O=S(=O)(O)OCC1OC(O)(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | KSSLMVRLMRHYQO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfateshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholsulfuric acid monoestertetrahydrofuranmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhemiacetalhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|