| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:02:27 UTC |
|---|
| Update Date | 2025-03-21 18:07:14 UTC |
|---|
| HMDB ID | HMDB0258272 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068026 |
|---|
| Name | Shikimate-3-phosphate |
|---|
| Frequency | 44.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11O8P |
|---|
| Molecular Mass | 254.0192 |
|---|
| SMILES | O=C(O)C1=CC(OP(=O)(O)O)C(O)C(O)C1 |
|---|
| InChI Key | QYOJSKGCWNAKGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acidscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcyclitol or derivativescarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativeorganooxygen compound1,2-diol |
|---|
