| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:28 UTC |
|---|
| Update Date | 2025-03-21 18:07:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068046 |
|---|
| Frequency | 44.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO9 |
|---|
| Molecular Mass | 309.106 |
|---|
| SMILES | CC(=O)NC1C(OC(=O)C(O)CO)OC(CO)C(O)C1O |
|---|
| InChI Key | DPHXTNRCXWNESU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-acyl-alpha-hexosamines |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessugar acids and derivatives |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminebeta-hydroxy acidorganic oxideacetalglyceric_acidaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholhydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|