| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:35 UTC |
|---|
| Update Date | 2025-03-21 18:07:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068332 |
|---|
| Frequency | 44.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H25NO5 |
|---|
| Molecular Mass | 323.1733 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(C(O)O)C(C)C(C)C2C)cc1 |
|---|
| InChI Key | RKPYQJBOULPDCS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarbonyl hydratescarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupcarbonyl hydraten-acetylarylaminearomatic heteromonocyclic compoundn-arylamidecarboxylic acid derivativeorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamideacetanilidecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|