| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:39 UTC |
|---|
| Update Date | 2025-03-21 18:07:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068516 |
|---|
| Frequency | 44.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H11O8P |
|---|
| Molecular Mass | 230.0192 |
|---|
| SMILES | O=C(CO)C(O)C(O)C(O)P(=O)(O)O |
|---|
| InChI Key | GUDFBGAOZDKZAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesbeta-hydroxy ketoneshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupmonosaccharidealpha-hydroxy ketoneketoneorganic oxideacyloinsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganophosphonic acid derivative |
|---|
