| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:40 UTC |
|---|
| Update Date | 2025-03-21 18:07:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068566 |
|---|
| Frequency | 44.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24O7 |
|---|
| Molecular Mass | 364.1522 |
|---|
| SMILES | COc1cc(CC(CO)C(CO)Cc2cc(O)c(O)c(O)c2)ccc1O |
|---|
| InChI Key | BRXDRZKDFPPMDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | dibenzylbutane lignans |
|---|
| Subclass | dibenzylbutane lignans |
|---|
| Direct Parent | dibenzylbutane lignans |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesmethoxyphenolsphenoxy compoundsprimary alcoholspyrogallols and derivatives |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyetherpyrogallol derivativebenzenetriol1-hydroxy-2-unsubstituted benzenoidmethoxyphenol1-hydroxy-4-unsubstituted benzenoidalkyl aryl ethermethoxybenzenearomatic homomonocyclic compounddibenzylbutane lignan skeletonorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundprimary alcoholorganooxygen compound |
|---|
