| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:46 UTC |
|---|
| Update Date | 2025-03-21 18:07:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068780 |
|---|
| Frequency | 44.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O2 |
|---|
| Molecular Mass | 222.0681 |
|---|
| SMILES | O=C(O)c1ccc2c(ccc3ccccc32)c1 |
|---|
| InChI Key | QTWYUOSZMIWHJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenecarboxylic acidsorganic oxidesorganooxygen compounds |
|---|
| Substituents | phenanthrenecarboxylic acidaromatic homopolycyclic compoundcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compound2-naphthalenecarboxylic acid or derivativeshydrocarbon derivative2-naphthalenecarboxylic acidorganooxygen compound |
|---|