| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:47 UTC |
|---|
| Update Date | 2025-03-21 18:07:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068838 |
|---|
| Frequency | 44.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO5 |
|---|
| Molecular Mass | 319.142 |
|---|
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)C(O)C1C1OC12 |
|---|
| InChI Key | KEOCMUPUQCIZPP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | beta hydroxy acids and derivatives |
|---|
| Direct Parent | beta hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid esterscyclic alcohols and derivativesdialkyl ethersepoxideshydrocarbon derivativesmonocarboxylic acids and derivativesmorpholinesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinesprimary alcoholssecondary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etherbeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidineprimary alcoholpiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidine1,2-aminoalcoholtertiary aliphatic amineoxiranecyclic alcoholoxazinaneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|