| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:50 UTC |
|---|
| Update Date | 2025-03-21 18:07:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00068956 |
|---|
| Frequency | 43.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O4 |
|---|
| Molecular Mass | 250.0954 |
|---|
| SMILES | COc1cc2c(CCNC(=O)O)c[nH]c2cc1O |
|---|
| InChI Key | BZRBJJRVRPEUIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundscarbamic acidscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | phenol ethercarbonyl groupethercarbonic acid derivativeazacyclecarbamic acidindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundanisolepyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
