| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:53 UTC |
|---|
| Update Date | 2025-03-21 18:07:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069087 |
|---|
| Frequency | 43.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9NO6S |
|---|
| Molecular Mass | 283.0151 |
|---|
| SMILES | O=C(CC(=O)c1c[nH]c2ccccc12)OS(=O)(=O)O |
|---|
| InChI Key | DPJLDJPWKFAJLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonesazacyclic compoundsbenzenoidsbeta-keto acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessulfuric acid monoestersvinylogous amides |
|---|
| Substituents | sulfuric acid monoestercarbonyl grouparyl alkyl ketoneindolecarboxylic acid derivativebeta-keto acidketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundvinylogous amideorganic sulfuric acid or derivativesazacycleheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compoundaryl ketone |
|---|