| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:02:53 UTC |
|---|
| Update Date | 2025-03-21 18:07:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069090 |
|---|
| Frequency | 43.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19NO3 |
|---|
| Molecular Mass | 297.1365 |
|---|
| SMILES | CN(C)C(=O)C(CC(=O)O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | KLQCUQIKQSQPFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidesphenylpropanoic acidstertiary carboxylic acid amides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acid3-phenylpropanoic-acidcarboxamide groupcarboxylic acid derivativen-acyl-aminearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenylacetamideorganooxygen compound |
|---|