DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 00:02:56 UTC
Update Date	2025-03-21 18:07:25 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00069191
Frequency	43.7
Structure
Chemical Formula	C₁₂H₁₄N₂O₅
Molecular Mass	266.0903
SMILES	NC(=O)CCC(NC(=O)c1ccc(O)cc1)C(=O)O
InChI Key	DUZTTZWZVFIUDQ-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	glutamine and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acids benzoyl derivatives carbonyl compounds carboxylic acids fatty amides hippuric acids and derivatives hydrocarbon derivatives monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds primary carboxylic acid amides secondary carboxylic acid amides
Substituents	primary carboxylic acid amide fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid glutamine or derivatives fatty amide benzoyl 1-hydroxy-2-unsubstituted benzenoid benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound n-acyl-alpha amino acid or derivatives n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid organic nitrogen compound organooxygen compound

Showing information for DMID00069191