| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:01 UTC |
|---|
| Update Date | 2025-03-21 18:07:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069402 |
|---|
| Frequency | 67.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N4O2 |
|---|
| Molecular Mass | 212.1273 |
|---|
| SMILES | NCCC(=O)NC(CO)Cc1cnc[nH]1 |
|---|
| InChI Key | MGGMJJQALOBCSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholcarbonyl grouparomatic heteromonocyclic compoundazacycleheteroaromatic compoundcarboxamide groupbeta amino acid or derivativessecondary carboxylic acid amideorganic oxideorganic oxygen compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compoundazole |
|---|
