| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:03:06 UTC |
|---|
| Update Date | 2025-03-21 18:07:29 UTC |
|---|
| HMDB ID | HMDB0244793 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069590 |
|---|
| Name | 6-Hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl 3-hydroxy-2-phenylpropanoate |
|---|
| Frequency | 43.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO4 |
|---|
| Molecular Mass | 305.1627 |
|---|
| SMILES | CN1C2CC(OC(=O)C(CO)c3ccccc3)CC1C(O)C2 |
|---|
| InChI Key | WTQYWNWRJNXDEG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | tropane alkaloids |
|---|
| Subclass | tropane alkaloids |
|---|
| Direct Parent | tropane alkaloids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamino acids and derivativesazacyclic compoundsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspiperidinesprimary alcoholssecondary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivativebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidineprimary alcoholpiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidine1,2-aminoalcoholtertiary aliphatic aminehydroxy acidcyclic alcoholmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
|---|
