| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:03:08 UTC |
|---|
| Update Date | 2025-03-21 18:07:29 UTC |
|---|
| HMDB ID | HMDB0135209 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069665 |
|---|
| Name | 3-hydroxy-1,3-diphenylpropan-1-one |
|---|
| Frequency | 43.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O2 |
|---|
| Molecular Mass | 226.0994 |
|---|
| SMILES | O=C(CC(O)c1ccccc1)c1ccccc1 |
|---|
| InChI Key | ZTCFOSQTSRNLHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesaromatic alcoholsaryl alkyl ketonesbenzoyl derivativesbeta-hydroxy ketonesbutyrophenoneshydrocarbon derivativeslinear 1,3-diarylpropanoidsorganic oxidessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholbeta-hydroxy ketonemonocyclic benzene moietyaryl alkyl ketonebenzoylretro-dihydrochalconephenylketoneketonebutyrophenonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
