| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:13 UTC |
|---|
| Update Date | 2025-03-21 18:07:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00069850 |
|---|
| Frequency | 43.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N2O6S |
|---|
| Molecular Mass | 248.0103 |
|---|
| SMILES | O=C1NC(=O)C(SCC(C(=O)O)C(=O)O)N1 |
|---|
| InChI Key | PBWNHWWJQAZPDK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha amino acidsazacyclic compoundscarboxylic acidsdialkylthioethersdicarboximidesdicarboxylic acids and derivativeshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundsthiohemiaminal derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compounddicarboximidecarbonic acid derivativesulfenyl compoundazacycledialkylthioetherorganic oxygen compoundhydantointhioetherdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compound1,3-dicarbonyl compoundorganooxygen compound |
|---|
