| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:18 UTC |
|---|
| Update Date | 2025-03-21 18:28:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070048 |
|---|
| Frequency | 43.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO4 |
|---|
| Molecular Mass | 207.0532 |
|---|
| SMILES | Nc1ccccc1C(=O)C(=O)CC(=O)O |
|---|
| InChI Key | YFPNAEHIPNKWHF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | butyrophenones |
|---|
| Direct Parent | butyrophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-diketonesamino acidsaryl ketonesbenzoyl derivativesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | beta-hydroxy ketonecarbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativebeta-keto acidketoneorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidealpha-diketonegamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundaryl ketone |
|---|
