| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:18 UTC |
|---|
| Update Date | 2025-03-21 18:28:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070060 |
|---|
| Frequency | 43.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23NO4 |
|---|
| Molecular Mass | 341.1627 |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(O)c1ccccc1)OC1CCOC1 |
|---|
| InChI Key | KSFWFDSNTCOVBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativesaromatic alcoholsbenzene and substituted derivativescarbamate esterscarbonyl compoundsdialkyl ethershydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic alcoholalcohollinear 1,3-diarylpropanoidmonocyclic benzene moietycarbonyl groupethercarbonic acid derivativearomatic heteromonocyclic compoundtetrahydrofurancarbamic acid esterdialkyl etheroxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundamphetamine or derivatives |
|---|
