| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:19 UTC |
|---|
| Update Date | 2025-03-21 18:28:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070102 |
|---|
| Frequency | 43.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15ClN2O5S |
|---|
| Molecular Mass | 370.039 |
|---|
| SMILES | COc1ccccc1CNc1cc(Cl)c(S(N)(=O)=O)cc1C(=O)O |
|---|
| InChI Key | HEOAOEQQMDNSTD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsalkyl aryl ethersamino acidsaminosulfonyl compoundsanisolesaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesphenoxy compoundsphenylalkylaminessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | phenol ethercarboxylic acidamino acid or derivativesorganochloridebenzoylorganonitrogen compound1-carboxy-2-haloaromatic compoundbenzenesulfonyl grouparyl chloridechlorobenzenevinylogous amidehalobenzoic acidbenzenesulfonamide4-halobenzoic acidmethoxybenzenesecondary aliphatic/aromatic aminearyl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundanisolehydrocarbon derivativehalobenzenephenoxy compoundamineorganosulfonic acid or derivativesetheramino acidalkyl aryl etherorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganopnictogen compoundbenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativessecondary aminemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenylalkylamineorganic nitrogen compoundorganooxygen compound |
|---|