| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:25 UTC |
|---|
| Update Date | 2025-03-21 18:28:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070330 |
|---|
| Frequency | 42.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N3O7P |
|---|
| Molecular Mass | 293.0413 |
|---|
| SMILES | Nc1ccn(C2OC(COP(=O)(O)O)C2O)c(=O)n1 |
|---|
| InChI Key | KPIIJTAKJLKXSL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminessecondary alcohols |
|---|
| Substituents | aromatic heteromonocyclic compoundpyrimidoneorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamalcoholcarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphateoxetanesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
