| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:25 UTC |
|---|
| Update Date | 2025-03-21 18:28:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070359 |
|---|
| Frequency | 42.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H9N3O5S2 |
|---|
| Molecular Mass | 230.9984 |
|---|
| SMILES | NC(CCS(=O)(=O)O)=NS(N)(=O)=O |
|---|
| InChI Key | YZPCVLWZQCNJQW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amidineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acidssulfonyls |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativesorganic sulfuric acid or derivativesorganosulfonic acidamidineorganosulfur compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
